About 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione
3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione (PubChem CID 66660197) has the molecular formula C15H12Br2F3NO3
and a molecular weight of 471.07 g/mol. Its IUPAC name is 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione.
Molecular Properties
| Compound Name | 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione |
| PubChem CID | 66660197 |
| Molecular Formula | C15H12Br2F3NO3 |
| Molecular Weight | 471.07 g/mol |
| Exact Mass | 468.91 |
| IUPAC Name | 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)C1c1c(Br)cc(OC(F)(F)F)cc1Br |
| InChI | InChI=1S/C15H12Br2F3NO3/c16-8-5-7(24-15(18,19)20)6-9(17)10(8)11-12(22)14(21-13(11)23)3-1-2-4-14/h5-6,11H,1-4H2,(H,21,23) |
| InChIKey | HOCQORRRFFIUOG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.07 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione?
The IUPAC name of 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione (CID 66660197) is 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione.
What is the SMILES notation for 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione?
The canonical SMILES for 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione is O=C1NC2(CCCC2)C(=O)C1c1c(Br)cc(OC(F)(F)F)cc1Br.
What is the InChIKey of 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione?
The InChIKey is HOCQORRRFFIUOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Br2F3NO3/c16-8-5-7(24-15(18,19)20)6-9(17)10(8)11-12(22)14(21-13(11)23)3-1-2-4-14/h5-6,11H,1-4H2,(H,21,23).
What are the key properties of 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione?
3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione has a molecular weight of 471.07 g/mol, XLogP of 4.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-1-azaspiro[4.4]nonane-2,4-dione is sourced from PubChem (CID 66660197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).