2-[(4,4-difluorocyclohexyl)amino]acetic acid

C8H13F2NO2 — CID 66660213

IUPAC2-[(4,4-difluorocyclohexyl)amino]acetic acid
SMILESO=C(O)CNC1CCC(F)(F)CC1
InChIInChI=1S/C8H13F2NO2/c9-8(10)3-1-6(2-4-8)11-5-7(12)13/h6,11H,1-5H2,(H,12,13)
InChIKeyMRWUCNWEXMDZQP-UHFFFAOYSA-N
MW193.19 g/mol
LogP1.24
Rot. Bonds3

About 2-[(4,4-difluorocyclohexyl)amino]acetic acid

2-[(4,4-difluorocyclohexyl)amino]acetic acid (PubChem CID 66660213) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is 2-[(4,4-difluorocyclohexyl)amino]acetic acid.

Molecular Properties

Compound Name2-[(4,4-difluorocyclohexyl)amino]acetic acid
PubChem CID66660213
Molecular FormulaC8H13F2NO2
Molecular Weight193.19 g/mol
Exact Mass193.09
IUPAC Name2-[(4,4-difluorocyclohexyl)amino]acetic acid
SMILESO=C(O)CNC1CCC(F)(F)CC1
InChIInChI=1S/C8H13F2NO2/c9-8(10)3-1-6(2-4-8)11-5-7(12)13/h6,11H,1-5H2,(H,12,13)
InChIKeyMRWUCNWEXMDZQP-UHFFFAOYSA-N
XLogP1.24
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.19
LogP ≤ 51.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(4,4-difluorocyclohexyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4,4-difluorocyclohexyl)amino]acetic acid?
The IUPAC name of 2-[(4,4-difluorocyclohexyl)amino]acetic acid (CID 66660213) is 2-[(4,4-difluorocyclohexyl)amino]acetic acid.
What is the SMILES notation for 2-[(4,4-difluorocyclohexyl)amino]acetic acid?
The canonical SMILES for 2-[(4,4-difluorocyclohexyl)amino]acetic acid is O=C(O)CNC1CCC(F)(F)CC1.
What is the InChIKey of 2-[(4,4-difluorocyclohexyl)amino]acetic acid?
The InChIKey is MRWUCNWEXMDZQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO2/c9-8(10)3-1-6(2-4-8)11-5-7(12)13/h6,11H,1-5H2,(H,12,13).
What are the key properties of 2-[(4,4-difluorocyclohexyl)amino]acetic acid?
2-[(4,4-difluorocyclohexyl)amino]acetic acid has a molecular weight of 193.19 g/mol, XLogP of 1.24, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-difluorocyclohexyl)amino]acetic acid is sourced from PubChem (CID 66660213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).