C21H26F2N4O2 — CID 66660457
3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 66660457) has the molecular formula C21H26F2N4O2 and a molecular weight of 404.46 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 66660457 |
| Molecular Formula | C21H26F2N4O2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | CNC(=O)C(NC(=O)c1nc(-c2ccc(F)c(F)c2)n2c1CCCC2)C(C)(C)C |
| InChI | InChI=1S/C21H26F2N4O2/c1-21(2,3)17(20(29)24-4)26-19(28)16-15-7-5-6-10-27(15)18(25-16)12-8-9-13(22)14(23)11-12/h8-9,11,17H,5-7,10H2,1-4H3,(H,24,29)(H,26,28) |
| InChIKey | XOZSQOZXORGOEV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |