About 2,5-dioxaspiro[3.4]octane
2,5-dioxaspiro[3.4]octane (PubChem CID 66660558) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is 2,5-dioxaspiro[3.4]octane.
Molecular Properties
| Compound Name | 2,5-dioxaspiro[3.4]octane |
| PubChem CID | 66660558 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 2,5-dioxaspiro[3.4]octane |
| SMILES | C1COC2(C1)COC2 |
| InChI | InChI=1S/C6H10O2/c1-2-6(8-3-1)4-7-5-6/h1-5H2 |
| InChIKey | MTHDIUXCZLYTAK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dioxaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dioxaspiro[3.4]octane?
The IUPAC name of 2,5-dioxaspiro[3.4]octane (CID 66660558) is 2,5-dioxaspiro[3.4]octane.
What is the SMILES notation for 2,5-dioxaspiro[3.4]octane?
The canonical SMILES for 2,5-dioxaspiro[3.4]octane is C1COC2(C1)COC2.
What is the InChIKey of 2,5-dioxaspiro[3.4]octane?
The InChIKey is MTHDIUXCZLYTAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2/c1-2-6(8-3-1)4-7-5-6/h1-5H2.
What are the key properties of 2,5-dioxaspiro[3.4]octane?
2,5-dioxaspiro[3.4]octane has a molecular weight of 114.14 g/mol, XLogP of 0.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dioxaspiro[3.4]octane is sourced from PubChem (CID 66660558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).