About 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole
4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole (PubChem CID 66660670) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole |
| PubChem CID | 66660670 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole |
| SMILES | CCCC(CC(C)CC1=CNCN1)C(C)C |
| InChI | InChI=1S/C14H28N2/c1-5-6-13(11(2)3)7-12(4)8-14-9-15-10-16-14/h9,11-13,15-16H,5-8,10H2,1-4H3 |
| InChIKey | UXHLVBWSRWXJMQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole?
The IUPAC name of 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole (CID 66660670) is 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole.
What is the SMILES notation for 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole?
The canonical SMILES for 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole is CCCC(CC(C)CC1=CNCN1)C(C)C.
What is the InChIKey of 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole?
The InChIKey is UXHLVBWSRWXJMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2/c1-5-6-13(11(2)3)7-12(4)8-14-9-15-10-16-14/h9,11-13,15-16H,5-8,10H2,1-4H3.
What are the key properties of 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole?
4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole has a molecular weight of 224.39 g/mol, XLogP of 3.47, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-4-propan-2-ylheptyl)-2,3-dihydro-1H-imidazole is sourced from PubChem (CID 66660670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).