C29H36N2O10 — CID 66660726
2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(3R)-3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one (PubChem CID 66660726) has the molecular formula C29H36N2O10 and a molecular weight of 572.61 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(3R)-3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one.
| Compound Name | 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(3R)-3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one |
|---|---|
| PubChem CID | 66660726 |
| Molecular Formula | C29H36N2O10 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(3R)-3-[(2-methylpropan-2-yl)oxymethyl]piperazin-2-one |
| SMILES | CC(C)(C)OC[C@H]1NCCNC1=O.Cc1ccc(C(=O)C(O)(C(=O)O)C(O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H18O8.C9H18N2O2/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14;1-9(2,3)13-6-7-8(12)11-5-4-10-7/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26);7,10H,4-6H2,1-3H3,(H,11,12)/t;7-/m.1/s1 |
| InChIKey | BGSBCWLETMTPHJ-HMZWWLAASA-N |
| XLogP | 0.89 |
| TPSA | 199.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|