About [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate
[3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate (PubChem CID 66660766) has the molecular formula C12H18N4O4
and a molecular weight of 282.30 g/mol. Its IUPAC name is [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate.
Molecular Properties
| Compound Name | [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate |
| PubChem CID | 66660766 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate |
| SMILES | CNC(=O)c1cc(COC(=O)NC2CCNCC2)on1 |
| InChI | InChI=1S/C12H18N4O4/c1-13-11(17)10-6-9(20-16-10)7-19-12(18)15-8-2-4-14-5-3-8/h6,8,14H,2-5,7H2,1H3,(H,13,17)(H,15,18) |
| InChIKey | ITQQUNNHIFHQCE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate?
The IUPAC name of [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate (CID 66660766) is [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate.
What is the SMILES notation for [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate?
The canonical SMILES for [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate is CNC(=O)c1cc(COC(=O)NC2CCNCC2)on1.
What is the InChIKey of [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate?
The InChIKey is ITQQUNNHIFHQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O4/c1-13-11(17)10-6-9(20-16-10)7-19-12(18)15-8-2-4-14-5-3-8/h6,8,14H,2-5,7H2,1H3,(H,13,17)(H,15,18).
What are the key properties of [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate?
[3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate has a molecular weight of 282.30 g/mol, XLogP of 0.01, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methylcarbamoyl)-1,2-oxazol-5-yl]methyl N-piperidin-4-ylcarbamate is sourced from PubChem (CID 66660766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).