C18H20ClNO2 — CID 66660910
methyl 7-(3-aminophenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate;hydrochloride (PubChem CID 66660910) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is methyl 7-(3-aminophenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate;hydrochloride.
| Compound Name | methyl 7-(3-aminophenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 66660910 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | methyl 7-(3-aminophenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CCc2ccc(-c3cccc(N)c3)cc2C1.Cl |
| InChI | InChI=1S/C18H19NO2.ClH/c1-21-18(20)15-8-6-12-5-7-14(9-16(12)10-15)13-3-2-4-17(19)11-13;/h2-5,7,9,11,15H,6,8,10,19H2,1H3;1H |
| InChIKey | PQNGBRWXWPFYTF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|