About ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate
ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate (PubChem CID 66660924) has the molecular formula C14H20FN3O5
and a molecular weight of 329.33 g/mol. Its IUPAC name is ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate |
| PubChem CID | 66660924 |
| Molecular Formula | C14H20FN3O5 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(COC(=O)NCC2(F)CCNCC2)on1 |
| InChI | InChI=1S/C14H20FN3O5/c1-2-21-12(19)11-7-10(23-18-11)8-22-13(20)17-9-14(15)3-5-16-6-4-14/h7,16H,2-6,8-9H2,1H3,(H,17,20) |
| InChIKey | FNEHPDCCOLSGDJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate (CID 66660924) is ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate is CCOC(=O)c1cc(COC(=O)NCC2(F)CCNCC2)on1.
What is the InChIKey of ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate?
The InChIKey is FNEHPDCCOLSGDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FN3O5/c1-2-21-12(19)11-7-10(23-18-11)8-22-13(20)17-9-14(15)3-5-16-6-4-14/h7,16H,2-6,8-9H2,1H3,(H,17,20).
What are the key properties of ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate?
ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate has a molecular weight of 329.33 g/mol, XLogP of 1.17, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(4-fluoropiperidin-4-yl)methylcarbamoyloxymethyl]-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 66660924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).