C26H31FN4O5 — CID 66660928
(3S)-3-(diethylaminomethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-N-(2-methoxyethyl)-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide (PubChem CID 66660928) has the molecular formula C26H31FN4O5 and a molecular weight of 498.56 g/mol. Its IUPAC name is (3S)-3-(diethylaminomethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-N-(2-methoxyethyl)-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide.
| Compound Name | (3S)-3-(diethylaminomethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-N-(2-methoxyethyl)-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 66660928 |
| Molecular Formula | C26H31FN4O5 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | (3S)-3-(diethylaminomethyl)-6-[(4-fluorophenyl)methyl]-10-hydroxy-N-(2-methoxyethyl)-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
| SMILES | CCN(CC)C[C@H]1Cn2c(=O)c(C(=O)NCCOC)c(O)c3ncc(Cc4ccc(F)cc4)c(c32)O1 |
| InChI | InChI=1S/C26H31FN4O5/c1-4-30(5-2)14-19-15-31-22-21(23(32)20(26(31)34)25(33)28-10-11-35-3)29-13-17(24(22)36-19)12-16-6-8-18(27)9-7-16/h6-9,13,19,32H,4-5,10-12,14-15H2,1-3H3,(H,28,33)/t19-/m0/s1 |
| InChIKey | UOABLWFTAODZIY-IBGZPJMESA-N |
| XLogP | 2.31 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|