About 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine
3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine (PubChem CID 66660986) has the molecular formula C45H89N2O2+
and a molecular weight of 690.22 g/mol. Its IUPAC name is 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine |
| PubChem CID | 66660986 |
| Molecular Formula | C45H89N2O2+ |
| Molecular Weight | 690.22 g/mol |
| Exact Mass | 689.69 |
| IUPAC Name | 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC1(OCCCCCCCC/C=C\CCCCCCCC)CC[N+](C)(CCCN)CC1 |
| InChI | InChI=1S/C45H89N2O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-43-48-45(37-41-47(3,42-38-45)40-36-39-46)49-44-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21H,4-17,22-44,46H2,1-3H3/q+1/b20-18-,21-19- |
| InChIKey | ZYBKUJSAFVVXFR-AUYXYSRISA-N |
| XLogP | 13.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 690.22 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine?
The IUPAC name of 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine (CID 66660986) is 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine.
What is the SMILES notation for 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine?
The canonical SMILES for 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine is CCCCCCCC/C=C\CCCCCCCCOC1(OCCCCCCCC/C=C\CCCCCCCC)CC[N+](C)(CCCN)CC1.
What is the InChIKey of 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine?
The InChIKey is ZYBKUJSAFVVXFR-AUYXYSRISA-N. The full InChI is InChI=1S/C45H89N2O2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-43-48-45(37-41-47(3,42-38-45)40-36-39-46)49-44-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21H,4-17,22-44,46H2,1-3H3/q+1/b20-18-,21-19-.
What are the key properties of 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine?
3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine has a molecular weight of 690.22 g/mol, XLogP of 13.38, 37 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-methyl-4,4-bis[(Z)-octadec-9-enoxy]piperidin-1-ium-1-yl]propan-1-amine is sourced from PubChem (CID 66660986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).