About 3-acetyl-6-methylpyran-2,4-dione;zinc
3-acetyl-6-methylpyran-2,4-dione;zinc (PubChem CID 66661169) has the molecular formula C8H8O4Zn
and a molecular weight of 233.54 g/mol. Its IUPAC name is 3-acetyl-6-methylpyran-2,4-dione;zinc.
Molecular Properties
| Compound Name | 3-acetyl-6-methylpyran-2,4-dione;zinc |
| PubChem CID | 66661169 |
| Molecular Formula | C8H8O4Zn |
| Molecular Weight | 233.54 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 3-acetyl-6-methylpyran-2,4-dione;zinc |
| SMILES | CC(=O)C1C(=O)C=C(C)OC1=O.[Zn] |
| InChI | InChI=1S/C8H8O4.Zn/c1-4-3-6(10)7(5(2)9)8(11)12-4;/h3,7H,1-2H3; |
| InChIKey | AUJLGKNJGDAXMX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.54 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-6-methylpyran-2,4-dione;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-6-methylpyran-2,4-dione;zinc?
The IUPAC name of 3-acetyl-6-methylpyran-2,4-dione;zinc (CID 66661169) is 3-acetyl-6-methylpyran-2,4-dione;zinc.
What is the SMILES notation for 3-acetyl-6-methylpyran-2,4-dione;zinc?
The canonical SMILES for 3-acetyl-6-methylpyran-2,4-dione;zinc is CC(=O)C1C(=O)C=C(C)OC1=O.[Zn].
What is the InChIKey of 3-acetyl-6-methylpyran-2,4-dione;zinc?
The InChIKey is AUJLGKNJGDAXMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4.Zn/c1-4-3-6(10)7(5(2)9)8(11)12-4;/h3,7H,1-2H3;.
What are the key properties of 3-acetyl-6-methylpyran-2,4-dione;zinc?
3-acetyl-6-methylpyran-2,4-dione;zinc has a molecular weight of 233.54 g/mol, XLogP of 0.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-6-methylpyran-2,4-dione;zinc is sourced from PubChem (CID 66661169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).