About (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid
(2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid (PubChem CID 66661172) has the molecular formula C16H26F2N2O3
and a molecular weight of 332.39 g/mol. Its IUPAC name is (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid.
Molecular Properties
| Compound Name | (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid |
| PubChem CID | 66661172 |
| Molecular Formula | C16H26F2N2O3 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid |
| SMILES | CC(F)(F)C[C@H](NC(=O)N1CCC2(CCCCC2)CC1)C(=O)O |
| InChI | InChI=1S/C16H26F2N2O3/c1-15(17,18)11-12(13(21)22)19-14(23)20-9-7-16(8-10-20)5-3-2-4-6-16/h12H,2-11H2,1H3,(H,19,23)(H,21,22)/t12-/m0/s1 |
| InChIKey | MCZMKQNJXXICMU-LBPRGKRZSA-N |
| XLogP | 3.24 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid?
The IUPAC name of (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid (CID 66661172) is (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid.
What is the SMILES notation for (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid?
The canonical SMILES for (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid is CC(F)(F)C[C@H](NC(=O)N1CCC2(CCCCC2)CC1)C(=O)O.
What is the InChIKey of (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid?
The InChIKey is MCZMKQNJXXICMU-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H26F2N2O3/c1-15(17,18)11-12(13(21)22)19-14(23)20-9-7-16(8-10-20)5-3-2-4-6-16/h12H,2-11H2,1H3,(H,19,23)(H,21,22)/t12-/m0/s1.
What are the key properties of (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid?
(2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid has a molecular weight of 332.39 g/mol, XLogP of 3.24, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3-azaspiro[5.5]undecane-3-carbonylamino)-4,4-difluoropentanoic acid is sourced from PubChem (CID 66661172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).