About 2-propyl-2,7-diazaspiro[3.5]nonane
2-propyl-2,7-diazaspiro[3.5]nonane (PubChem CID 66661314) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-propyl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 2-propyl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 66661314 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-propyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CCCN1CC2(CCNCC2)C1 |
| InChI | InChI=1S/C10H20N2/c1-2-7-12-8-10(9-12)3-5-11-6-4-10/h11H,2-9H2,1H3 |
| InChIKey | CNNSJIWULWVMAD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propyl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of 2-propyl-2,7-diazaspiro[3.5]nonane (CID 66661314) is 2-propyl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for 2-propyl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for 2-propyl-2,7-diazaspiro[3.5]nonane is CCCN1CC2(CCNCC2)C1.
What is the InChIKey of 2-propyl-2,7-diazaspiro[3.5]nonane?
The InChIKey is CNNSJIWULWVMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-2-7-12-8-10(9-12)3-5-11-6-4-10/h11H,2-9H2,1H3.
What are the key properties of 2-propyl-2,7-diazaspiro[3.5]nonane?
2-propyl-2,7-diazaspiro[3.5]nonane has a molecular weight of 168.28 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 66661314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).