C27H32FN5O7S — CID 66661360
(3S)-6-[(4-fluorophenyl)methyl]-10-hydroxy-N-(2-methoxyethyl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide (PubChem CID 66661360) has the molecular formula C27H32FN5O7S and a molecular weight of 589.65 g/mol. Its IUPAC name is (3S)-6-[(4-fluorophenyl)methyl]-10-hydroxy-N-(2-methoxyethyl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide.
| Compound Name | (3S)-6-[(4-fluorophenyl)methyl]-10-hydroxy-N-(2-methoxyethyl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 66661360 |
| Molecular Formula | C27H32FN5O7S |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.20 |
| IUPAC Name | (3S)-6-[(4-fluorophenyl)methyl]-10-hydroxy-N-(2-methoxyethyl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
| SMILES | COCCNC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)C[C@H](CN1CCN(S(C)(=O)=O)CC1)O3 |
| InChI | InChI=1S/C27H32FN5O7S/c1-39-12-7-29-26(35)21-24(34)22-23-25(18(14-30-22)13-17-3-5-19(28)6-4-17)40-20(16-33(23)27(21)36)15-31-8-10-32(11-9-31)41(2,37)38/h3-6,14,20,34H,7-13,15-16H2,1-2H3,(H,29,35)/t20-/m0/s1 |
| InChIKey | ZPSBHBCXUSHOTJ-FQEVSTJZSA-N |
| XLogP | 0.55 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|