About prop-2-enoxymethyl 2-tritylprop-2-enoate
prop-2-enoxymethyl 2-tritylprop-2-enoate (PubChem CID 66662871) has the molecular formula C26H24O3
and a molecular weight of 384.48 g/mol. Its IUPAC name is prop-2-enoxymethyl 2-tritylprop-2-enoate.
Molecular Properties
| Compound Name | prop-2-enoxymethyl 2-tritylprop-2-enoate |
| PubChem CID | 66662871 |
| Molecular Formula | C26H24O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | prop-2-enoxymethyl 2-tritylprop-2-enoate |
| SMILES | C=CCOCOC(=O)C(=C)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24O3/c1-3-19-28-20-29-25(27)21(2)26(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h3-18H,1-2,19-20H2 |
| InChIKey | JZQWSJBVNOEYCI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoxymethyl 2-tritylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoxymethyl 2-tritylprop-2-enoate?
The IUPAC name of prop-2-enoxymethyl 2-tritylprop-2-enoate (CID 66662871) is prop-2-enoxymethyl 2-tritylprop-2-enoate.
What is the SMILES notation for prop-2-enoxymethyl 2-tritylprop-2-enoate?
The canonical SMILES for prop-2-enoxymethyl 2-tritylprop-2-enoate is C=CCOCOC(=O)C(=C)C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of prop-2-enoxymethyl 2-tritylprop-2-enoate?
The InChIKey is JZQWSJBVNOEYCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24O3/c1-3-19-28-20-29-25(27)21(2)26(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h3-18H,1-2,19-20H2.
What are the key properties of prop-2-enoxymethyl 2-tritylprop-2-enoate?
prop-2-enoxymethyl 2-tritylprop-2-enoate has a molecular weight of 384.48 g/mol, XLogP of 5.28, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoxymethyl 2-tritylprop-2-enoate is sourced from PubChem (CID 66662871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).