About prop-2-enoxymethyl 2-cyclopentylprop-2-enoate
prop-2-enoxymethyl 2-cyclopentylprop-2-enoate (PubChem CID 66662989) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is prop-2-enoxymethyl 2-cyclopentylprop-2-enoate.
Molecular Properties
| Compound Name | prop-2-enoxymethyl 2-cyclopentylprop-2-enoate |
| PubChem CID | 66662989 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | prop-2-enoxymethyl 2-cyclopentylprop-2-enoate |
| SMILES | C=CCOCOC(=O)C(=C)C1CCCC1 |
| InChI | InChI=1S/C12H18O3/c1-3-8-14-9-15-12(13)10(2)11-6-4-5-7-11/h3,11H,1-2,4-9H2 |
| InChIKey | GBNOPCGGLKOWJP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoxymethyl 2-cyclopentylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoxymethyl 2-cyclopentylprop-2-enoate?
The IUPAC name of prop-2-enoxymethyl 2-cyclopentylprop-2-enoate (CID 66662989) is prop-2-enoxymethyl 2-cyclopentylprop-2-enoate.
What is the SMILES notation for prop-2-enoxymethyl 2-cyclopentylprop-2-enoate?
The canonical SMILES for prop-2-enoxymethyl 2-cyclopentylprop-2-enoate is C=CCOCOC(=O)C(=C)C1CCCC1.
What is the InChIKey of prop-2-enoxymethyl 2-cyclopentylprop-2-enoate?
The InChIKey is GBNOPCGGLKOWJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-3-8-14-9-15-12(13)10(2)11-6-4-5-7-11/h3,11H,1-2,4-9H2.
What are the key properties of prop-2-enoxymethyl 2-cyclopentylprop-2-enoate?
prop-2-enoxymethyl 2-cyclopentylprop-2-enoate has a molecular weight of 210.27 g/mol, XLogP of 2.44, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoxymethyl 2-cyclopentylprop-2-enoate is sourced from PubChem (CID 66662989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).