C7H11NO3 — CID 66663244
N,6-dimethyl-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 66663244) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is N,6-dimethyl-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N,6-dimethyl-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 66663244 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N,6-dimethyl-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | CNC(=O)C1=C(C)OCCO1 |
| InChI | InChI=1S/C7H11NO3/c1-5-6(7(9)8-2)11-4-3-10-5/h3-4H2,1-2H3,(H,8,9) |
| InChIKey | CHFWMFIHLHKMET-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |