About (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate
(1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate (PubChem CID 66663792) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate.
Molecular Properties
| Compound Name | (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate |
| PubChem CID | 66663792 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate |
| SMILES | CC(=O)OC1(N)CCc2ccc(C)cc21 |
| InChI | InChI=1S/C12H15NO2/c1-8-3-4-10-5-6-12(13,11(10)7-8)15-9(2)14/h3-4,7H,5-6,13H2,1-2H3 |
| InChIKey | WQNXTSIEXJKRMD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate?
The IUPAC name of (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate (CID 66663792) is (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate.
What is the SMILES notation for (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate?
The canonical SMILES for (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate is CC(=O)OC1(N)CCc2ccc(C)cc21.
What is the InChIKey of (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate?
The InChIKey is WQNXTSIEXJKRMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-8-3-4-10-5-6-12(13,11(10)7-8)15-9(2)14/h3-4,7H,5-6,13H2,1-2H3.
What are the key properties of (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate?
(1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate has a molecular weight of 205.26 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-6-methyl-2,3-dihydroinden-1-yl) acetate is sourced from PubChem (CID 66663792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).