C18H26F3N3O3 — CID 66663823
N,N-diethyl-2-phenyl-2-piperazin-1-ylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 66663823) has the molecular formula C18H26F3N3O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is N,N-diethyl-2-phenyl-2-piperazin-1-ylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-diethyl-2-phenyl-2-piperazin-1-ylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66663823 |
| Molecular Formula | C18H26F3N3O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N,N-diethyl-2-phenyl-2-piperazin-1-ylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)C(=O)C(c1ccccc1)N1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O.C2HF3O2/c1-3-18(4-2)16(20)15(14-8-6-5-7-9-14)19-12-10-17-11-13-19;3-2(4,5)1(6)7/h5-9,15,17H,3-4,10-13H2,1-2H3;(H,6,7) |
| InChIKey | LVHBTAFOWSYDEP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |