About 2,2-diethylpyridin-1-amine
2,2-diethylpyridin-1-amine (PubChem CID 66664477) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,2-diethylpyridin-1-amine.
Molecular Properties
| Compound Name | 2,2-diethylpyridin-1-amine |
| PubChem CID | 66664477 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2,2-diethylpyridin-1-amine |
| SMILES | CCC1(CC)C=CC=CN1N |
| InChI | InChI=1S/C9H16N2/c1-3-9(4-2)7-5-6-8-11(9)10/h5-8H,3-4,10H2,1-2H3 |
| InChIKey | TXSKTWQOPPFLTF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethylpyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethylpyridin-1-amine?
The IUPAC name of 2,2-diethylpyridin-1-amine (CID 66664477) is 2,2-diethylpyridin-1-amine.
What is the SMILES notation for 2,2-diethylpyridin-1-amine?
The canonical SMILES for 2,2-diethylpyridin-1-amine is CCC1(CC)C=CC=CN1N.
What is the InChIKey of 2,2-diethylpyridin-1-amine?
The InChIKey is TXSKTWQOPPFLTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-3-9(4-2)7-5-6-8-11(9)10/h5-8H,3-4,10H2,1-2H3.
What are the key properties of 2,2-diethylpyridin-1-amine?
2,2-diethylpyridin-1-amine has a molecular weight of 152.24 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethylpyridin-1-amine is sourced from PubChem (CID 66664477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).