About (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid
(2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid (PubChem CID 66664606) has the molecular formula C10H17N3O4S
and a molecular weight of 275.33 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid |
| PubChem CID | 66664606 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.O=C(O)c1nccs1 |
| InChI | InChI=1S/C6H14N2O2.C4H3NO2S/c7-4-2-1-3-5(8)6(9)10;6-4(7)3-5-1-2-8-3/h5H,1-4,7-8H2,(H,9,10);1-2H,(H,6,7)/t5-;/m0./s1 |
| InChIKey | DZPNAHMBNCBROI-JEDNCBNOSA-N |
| XLogP | 0.37 |
| TPSA | 139.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid?
The IUPAC name of (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid (CID 66664606) is (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid?
The canonical SMILES for (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid is NCCCC[C@H](N)C(=O)O.O=C(O)c1nccs1.
What is the InChIKey of (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid?
The InChIKey is DZPNAHMBNCBROI-JEDNCBNOSA-N. The full InChI is InChI=1S/C6H14N2O2.C4H3NO2S/c7-4-2-1-3-5(8)6(9)10;6-4(7)3-5-1-2-8-3/h5H,1-4,7-8H2,(H,9,10);1-2H,(H,6,7)/t5-;/m0./s1.
What are the key properties of (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid?
(2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid has a molecular weight of 275.33 g/mol, XLogP of 0.37, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,6-diaminohexanoic acid;1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 66664606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).