About Cyclopropanesulfinic acid sodium
Cyclopropanesulfinic acid sodium (PubChem CID 66664624) has the molecular formula C3H6NaO2S
and a molecular weight of 129.14 g/mol.
Molecular Properties
| Compound Name | Cyclopropanesulfinic acid sodium |
| PubChem CID | 66664624 |
| Molecular Formula | C3H6NaO2S |
| Molecular Weight | 129.14 g/mol |
| Exact Mass | 129.00 |
| IUPAC Name | — |
| SMILES | O=S(O)C1CC1.[Na] |
| InChI | InChI=1S/C3H6O2S.Na/c4-6(5)3-1-2-3;/h3H,1-2H2,(H,4,5); |
| InChIKey | NUBVYMVIDBFFMP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze Cyclopropanesulfinic acid sodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyclopropanesulfinic acid sodium?
The IUPAC name of Cyclopropanesulfinic acid sodium (CID 66664624) is not available.
What is the SMILES notation for Cyclopropanesulfinic acid sodium?
The canonical SMILES for Cyclopropanesulfinic acid sodium is O=S(O)C1CC1.[Na].
What is the InChIKey of Cyclopropanesulfinic acid sodium?
The InChIKey is NUBVYMVIDBFFMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2S.Na/c4-6(5)3-1-2-3;/h3H,1-2H2,(H,4,5);.
What are the key properties of Cyclopropanesulfinic acid sodium?
Cyclopropanesulfinic acid sodium has a molecular weight of 129.14 g/mol, XLogP of -0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclopropanesulfinic acid sodium is sourced from PubChem (CID 66664624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).