About cis-(1R,2S)-3-methylcyclopentane-1,2-diol
cis-(1R,2S)-3-methylcyclopentane-1,2-diol (PubChem CID 66664692) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is cis-(1R,2S)-3-methylcyclopentane-1,2-diol.
Molecular Properties
| Compound Name | cis-(1R,2S)-3-methylcyclopentane-1,2-diol |
| PubChem CID | 66664692 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | cis-(1R,2S)-3-methylcyclopentane-1,2-diol |
| SMILES | CC1CC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O2/c1-4-2-3-5(7)6(4)8/h4-8H,2-3H2,1H3/t4?,5-,6+/m1/s1 |
| InChIKey | KANFKJUPLALTDB-UVCATTPVSA-N |
| XLogP | 0.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1R,2S)-3-methylcyclopentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-3-methylcyclopentane-1,2-diol?
The IUPAC name of cis-(1R,2S)-3-methylcyclopentane-1,2-diol (CID 66664692) is cis-(1R,2S)-3-methylcyclopentane-1,2-diol.
What is the SMILES notation for cis-(1R,2S)-3-methylcyclopentane-1,2-diol?
The canonical SMILES for cis-(1R,2S)-3-methylcyclopentane-1,2-diol is CC1CC[C@@H](O)[C@H]1O.
What is the InChIKey of cis-(1R,2S)-3-methylcyclopentane-1,2-diol?
The InChIKey is KANFKJUPLALTDB-UVCATTPVSA-N. The full InChI is InChI=1S/C6H12O2/c1-4-2-3-5(7)6(4)8/h4-8H,2-3H2,1H3/t4?,5-,6+/m1/s1.
What are the key properties of cis-(1R,2S)-3-methylcyclopentane-1,2-diol?
cis-(1R,2S)-3-methylcyclopentane-1,2-diol has a molecular weight of 116.16 g/mol, XLogP of 0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-3-methylcyclopentane-1,2-diol is sourced from PubChem (CID 66664692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).