About 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea
1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea (PubChem CID 66664894) has the molecular formula C12H17N5O
and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea |
| PubChem CID | 66664894 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea |
| SMILES | CC1C=CC=C(CNC(=O)Nc2cn(C)cn2)N1 |
| InChI | InChI=1S/C12H17N5O/c1-9-4-3-5-10(15-9)6-13-12(18)16-11-7-17(2)8-14-11/h3-5,7-9,15H,6H2,1-2H3,(H2,13,16,18) |
| InChIKey | JJBVIIDPLPLKHH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea?
The IUPAC name of 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea (CID 66664894) is 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea.
What is the SMILES notation for 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea?
The canonical SMILES for 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea is CC1C=CC=C(CNC(=O)Nc2cn(C)cn2)N1.
What is the InChIKey of 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea?
The InChIKey is JJBVIIDPLPLKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O/c1-9-4-3-5-10(15-9)6-13-12(18)16-11-7-17(2)8-14-11/h3-5,7-9,15H,6H2,1-2H3,(H2,13,16,18).
What are the key properties of 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea?
1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea has a molecular weight of 247.30 g/mol, XLogP of 0.97, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methyl-1,2-dihydropyridin-6-yl)methyl]-3-(1-methylimidazol-4-yl)urea is sourced from PubChem (CID 66664894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).