C20H28FN3O — CID 66665530
1-[1-(1-cyclohexylethyl)-5-[(2-fluorophenyl)methoxy]pyrazol-3-yl]-N-methylmethanamine (PubChem CID 66665530) has the molecular formula C20H28FN3O and a molecular weight of 345.46 g/mol. Its IUPAC name is 1-[1-(1-cyclohexylethyl)-5-[(2-fluorophenyl)methoxy]pyrazol-3-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(1-cyclohexylethyl)-5-[(2-fluorophenyl)methoxy]pyrazol-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 66665530 |
| Molecular Formula | C20H28FN3O |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-[1-(1-cyclohexylethyl)-5-[(2-fluorophenyl)methoxy]pyrazol-3-yl]-N-methylmethanamine |
| SMILES | CNCc1cc(OCc2ccccc2F)n(C(C)C2CCCCC2)n1 |
| InChI | InChI=1S/C20H28FN3O/c1-15(16-8-4-3-5-9-16)24-20(12-18(23-24)13-22-2)25-14-17-10-6-7-11-19(17)21/h6-7,10-12,15-16,22H,3-5,8-9,13-14H2,1-2H3 |
| InChIKey | IMEQOYOQOIXODX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |