C31H39N3O2 — CID 66665673
ethyl 8-[2,3-bis(4-methylphenyl)-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-5-yl]octanoate (PubChem CID 66665673) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is ethyl 8-[2,3-bis(4-methylphenyl)-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-5-yl]octanoate.
| Compound Name | ethyl 8-[2,3-bis(4-methylphenyl)-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-5-yl]octanoate |
|---|---|
| PubChem CID | 66665673 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | ethyl 8-[2,3-bis(4-methylphenyl)-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-5-yl]octanoate |
| SMILES | CCOC(=O)CCCCCCCN1CCCc2nc(-c3ccc(C)cc3)c(-c3ccc(C)cc3)nc21 |
| InChI | InChI=1S/C31H39N3O2/c1-4-36-28(35)12-8-6-5-7-9-21-34-22-10-11-27-31(34)33-30(26-19-15-24(3)16-20-26)29(32-27)25-17-13-23(2)14-18-25/h13-20H,4-12,21-22H2,1-3H3 |
| InChIKey | HMYVCDKSHVQHGQ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|