C27H31N3O3 — CID 66665827
7-(8-methoxy-2,3-diphenyl-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-5-yl)heptanoic acid (PubChem CID 66665827) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is 7-(8-methoxy-2,3-diphenyl-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-5-yl)heptanoic acid.
| Compound Name | 7-(8-methoxy-2,3-diphenyl-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-5-yl)heptanoic acid |
|---|---|
| PubChem CID | 66665827 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 7-(8-methoxy-2,3-diphenyl-7,8-dihydro-6H-pyrido[2,3-b]pyrazin-5-yl)heptanoic acid |
| SMILES | COC1CCN(CCCCCCC(=O)O)c2nc(-c3ccccc3)c(-c3ccccc3)nc21 |
| InChI | InChI=1S/C27H31N3O3/c1-33-22-17-19-30(18-11-3-2-10-16-23(31)32)27-26(22)28-24(20-12-6-4-7-13-20)25(29-27)21-14-8-5-9-15-21/h4-9,12-15,22H,2-3,10-11,16-19H2,1H3,(H,31,32) |
| InChIKey | YDRFGMGFIQJAQP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|