C13H20O — CID 66665834
7-(cyclohepten-1-yl)-2,3,4,5-tetrahydrooxepine (PubChem CID 66665834) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 7-(cyclohepten-1-yl)-2,3,4,5-tetrahydrooxepine.
| Compound Name | 7-(cyclohepten-1-yl)-2,3,4,5-tetrahydrooxepine |
|---|---|
| PubChem CID | 66665834 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 7-(cyclohepten-1-yl)-2,3,4,5-tetrahydrooxepine |
| SMILES | C1=C(C2=CCCCCO2)CCCCC1 |
| InChI | InChI=1S/C13H20O/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-14-13/h8,10H,1-7,9,11H2 |
| InChIKey | UHZXPFSCJFEFPS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |