About methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride
methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride (PubChem CID 66666059) has the molecular formula C11H16ClNO4
and a molecular weight of 261.70 g/mol. Its IUPAC name is methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride |
| PubChem CID | 66666059 |
| Molecular Formula | C11H16ClNO4 |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride |
| SMILES | COC(=O)C1C2CCC(C(=O)C(=O)C2)C1N.Cl |
| InChI | InChI=1S/C11H15NO4.ClH/c1-16-11(15)8-5-2-3-6(9(8)12)10(14)7(13)4-5;/h5-6,8-9H,2-4,12H2,1H3;1H |
| InChIKey | QTBPEIHABJWDFV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride?
The IUPAC name of methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride (CID 66666059) is methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride.
What is the SMILES notation for methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride?
The canonical SMILES for methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride is COC(=O)C1C2CCC(C(=O)C(=O)C2)C1N.Cl.
What is the InChIKey of methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride?
The InChIKey is QTBPEIHABJWDFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4.ClH/c1-16-11(15)8-5-2-3-6(9(8)12)10(14)7(13)4-5;/h5-6,8-9H,2-4,12H2,1H3;1H.
What are the key properties of methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride?
methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride has a molecular weight of 261.70 g/mol, XLogP of 0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-amino-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate;hydrochloride is sourced from PubChem (CID 66666059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).