About 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine
2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine (PubChem CID 66666456) has the molecular formula C33H22BrN3
and a molecular weight of 540.46 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| PubChem CID | 66666456 |
| Molecular Formula | C33H22BrN3 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| SMILES | Brc1cccc(-c2nc(-c3cccc(-c4ccccc4)c3)nc(-c3cccc(-c4ccccc4)c3)n2)c1 |
| InChI | InChI=1S/C33H22BrN3/c34-30-19-9-18-29(22-30)33-36-31(27-16-7-14-25(20-27)23-10-3-1-4-11-23)35-32(37-33)28-17-8-15-26(21-28)24-12-5-2-6-13-24/h1-22H |
| InChIKey | IGEOJLLSRMEXLW-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine?
The IUPAC name of 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine (CID 66666456) is 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
What is the SMILES notation for 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine?
The canonical SMILES for 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine is Brc1cccc(-c2nc(-c3cccc(-c4ccccc4)c3)nc(-c3cccc(-c4ccccc4)c3)n2)c1.
What is the InChIKey of 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine?
The InChIKey is IGEOJLLSRMEXLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H22BrN3/c34-30-19-9-18-29(22-30)33-36-31(27-16-7-14-25(20-27)23-10-3-1-4-11-23)35-32(37-33)28-17-8-15-26(21-28)24-12-5-2-6-13-24/h1-22H.
What are the key properties of 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine?
2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine has a molecular weight of 540.46 g/mol, XLogP of 8.97, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)-4,6-bis(3-phenylphenyl)-1,3,5-triazine is sourced from PubChem (CID 66666456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).