C19H18ClN3O4S — CID 66666697
4-(4-chloro-3-ethylphenoxy)-N-methylsulfonyl-3-(1H-pyrazol-5-yl)benzamide (PubChem CID 66666697) has the molecular formula C19H18ClN3O4S and a molecular weight of 419.89 g/mol. Its IUPAC name is 4-(4-chloro-3-ethylphenoxy)-N-methylsulfonyl-3-(1H-pyrazol-5-yl)benzamide.
| Compound Name | 4-(4-chloro-3-ethylphenoxy)-N-methylsulfonyl-3-(1H-pyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 66666697 |
| Molecular Formula | C19H18ClN3O4S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 4-(4-chloro-3-ethylphenoxy)-N-methylsulfonyl-3-(1H-pyrazol-5-yl)benzamide |
| SMILES | CCc1cc(Oc2ccc(C(=O)NS(C)(=O)=O)cc2-c2ccn[nH]2)ccc1Cl |
| InChI | InChI=1S/C19H18ClN3O4S/c1-3-12-10-14(5-6-16(12)20)27-18-7-4-13(19(24)23-28(2,25)26)11-15(18)17-8-9-21-22-17/h4-11H,3H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | GTVHEIJPYOCNJF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |