About methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride
methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride (PubChem CID 66667743) has the molecular formula C8H11ClN2O2
and a molecular weight of 202.64 g/mol. Its IUPAC name is methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride |
| PubChem CID | 66667743 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccc(CN)nc1.Cl |
| InChI | InChI=1S/C8H10N2O2.ClH/c1-12-8(11)6-2-3-7(4-9)10-5-6;/h2-3,5H,4,9H2,1H3;1H |
| InChIKey | ACICMJBJQPLWKY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride?
The IUPAC name of methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride (CID 66667743) is methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride.
What is the SMILES notation for methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride?
The canonical SMILES for methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride is COC(=O)c1ccc(CN)nc1.Cl.
What is the InChIKey of methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride?
The InChIKey is ACICMJBJQPLWKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2.ClH/c1-12-8(11)6-2-3-7(4-9)10-5-6;/h2-3,5H,4,9H2,1H3;1H.
What are the key properties of methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride?
methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride has a molecular weight of 202.64 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(aminomethyl)pyridine-3-carboxylate;hydrochloride is sourced from PubChem (CID 66667743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).