About oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate
oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate (PubChem CID 66667757) has the molecular formula C23H22N2O3
and a molecular weight of 374.44 g/mol. Its IUPAC name is oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate.
Molecular Properties
| Compound Name | oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
| PubChem CID | 66667757 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate |
| SMILES | CCCCC#CC(C)OC(=O)c1c2ccccc2n2cc(OCC#N)ccc12 |
| InChI | InChI=1S/C23H22N2O3/c1-3-4-5-6-9-17(2)28-23(26)22-19-10-7-8-11-20(19)25-16-18(27-15-14-24)12-13-21(22)25/h7-8,10-13,16-17H,3-5,15H2,1-2H3 |
| InChIKey | AMCCOCSYBJKROW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
The IUPAC name of oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate (CID 66667757) is oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate.
What is the SMILES notation for oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
The canonical SMILES for oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate is CCCCC#CC(C)OC(=O)c1c2ccccc2n2cc(OCC#N)ccc12.
What is the InChIKey of oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
The InChIKey is AMCCOCSYBJKROW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O3/c1-3-4-5-6-9-17(2)28-23(26)22-19-10-7-8-11-20(19)25-16-18(27-15-14-24)12-13-21(22)25/h7-8,10-13,16-17H,3-5,15H2,1-2H3.
What are the key properties of oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate?
oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate has a molecular weight of 374.44 g/mol, XLogP of 4.73, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oct-3-yn-2-yl 7-(cyanomethoxy)pyrido[1,2-a]indole-10-carboxylate is sourced from PubChem (CID 66667757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).