About spiro[cyclohexane-1,2'-indole]
spiro[cyclohexane-1,2'-indole] (PubChem CID 66668100) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is spiro[cyclohexane-1,2'-indole].
Molecular Properties
| Compound Name | spiro[cyclohexane-1,2'-indole] |
| PubChem CID | 66668100 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | spiro[cyclohexane-1,2'-indole] |
| SMILES | C1=c2ccccc2=NC12CCCCC2 |
| InChI | InChI=1S/C13H15N/c1-4-8-13(9-5-1)10-11-6-2-3-7-12(11)14-13/h2-3,6-7,10H,1,4-5,8-9H2 |
| InChIKey | OTFFBEKDAOGPDO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[cyclohexane-1,2'-indole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[cyclohexane-1,2'-indole]?
The IUPAC name of spiro[cyclohexane-1,2'-indole] (CID 66668100) is spiro[cyclohexane-1,2'-indole].
What is the SMILES notation for spiro[cyclohexane-1,2'-indole]?
The canonical SMILES for spiro[cyclohexane-1,2'-indole] is C1=c2ccccc2=NC12CCCCC2.
What is the InChIKey of spiro[cyclohexane-1,2'-indole]?
The InChIKey is OTFFBEKDAOGPDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-4-8-13(9-5-1)10-11-6-2-3-7-12(11)14-13/h2-3,6-7,10H,1,4-5,8-9H2.
What are the key properties of spiro[cyclohexane-1,2'-indole]?
spiro[cyclohexane-1,2'-indole] has a molecular weight of 185.27 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[cyclohexane-1,2'-indole] is sourced from PubChem (CID 66668100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).