About 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid
4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid (PubChem CID 66668236) has the molecular formula C20H16FNO5
and a molecular weight of 369.35 g/mol. Its IUPAC name is 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid |
| PubChem CID | 66668236 |
| Molecular Formula | C20H16FNO5 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(C(O)CO)cc(-c2ccc(Oc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C20H16FNO5/c21-14-3-7-16(8-4-14)27-15-5-1-12(2-6-15)17-9-13(19(24)11-23)10-18(22-17)20(25)26/h1-10,19,23-24H,11H2,(H,25,26) |
| InChIKey | NRMRWPRNKVXHAP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid?
The IUPAC name of 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid (CID 66668236) is 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid?
The canonical SMILES for 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid is O=C(O)c1cc(C(O)CO)cc(-c2ccc(Oc3ccc(F)cc3)cc2)n1.
What is the InChIKey of 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid?
The InChIKey is NRMRWPRNKVXHAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FNO5/c21-14-3-7-16(8-4-14)27-15-5-1-12(2-6-15)17-9-13(19(24)11-23)10-18(22-17)20(25)26/h1-10,19,23-24H,11H2,(H,25,26).
What are the key properties of 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid?
4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid has a molecular weight of 369.35 g/mol, XLogP of 3.40, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-dihydroxyethyl)-6-[4-(4-fluorophenoxy)phenyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 66668236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).