C25H23NO2 — CID 66668722
3-[4-(3-hydroxyprop-1-ynyl)phenyl]-3-(2-methylphenyl)-1-(2-methyl-4-pyridinyl)propan-1-one (PubChem CID 66668722) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-[4-(3-hydroxyprop-1-ynyl)phenyl]-3-(2-methylphenyl)-1-(2-methyl-4-pyridinyl)propan-1-one.
| Compound Name | 3-[4-(3-hydroxyprop-1-ynyl)phenyl]-3-(2-methylphenyl)-1-(2-methyl-4-pyridinyl)propan-1-one |
|---|---|
| PubChem CID | 66668722 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-[4-(3-hydroxyprop-1-ynyl)phenyl]-3-(2-methylphenyl)-1-(2-methyl-4-pyridinyl)propan-1-one |
| SMILES | Cc1cc(C(=O)CC(c2ccc(C#CCO)cc2)c2ccccc2C)ccn1 |
| InChI | InChI=1S/C25H23NO2/c1-18-6-3-4-8-23(18)24(17-25(28)22-13-14-26-19(2)16-22)21-11-9-20(10-12-21)7-5-15-27/h3-4,6,8-14,16,24,27H,15,17H2,1-2H3 |
| InChIKey | XIFPMSLPZLHIMS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|