C14H14F2N2O2 — CID 66668959
1-[3-(difluoromethyl)-1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]ethanone (PubChem CID 66668959) has the molecular formula C14H14F2N2O2 and a molecular weight of 280.27 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]ethanone.
| Compound Name | 1-[3-(difluoromethyl)-1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 66668959 |
| Molecular Formula | C14H14F2N2O2 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-[3-(difluoromethyl)-1-[(4-methoxyphenyl)methyl]pyrazol-4-yl]ethanone |
| SMILES | COc1ccc(Cn2cc(C(C)=O)c(C(F)F)n2)cc1 |
| InChI | InChI=1S/C14H14F2N2O2/c1-9(19)12-8-18(17-13(12)14(15)16)7-10-3-5-11(20-2)6-4-10/h3-6,8,14H,7H2,1-2H3 |
| InChIKey | HWUZOXHNHUYHKZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |