About 1H-1,2-benzodiazepine;diazepane
1H-1,2-benzodiazepine;diazepane (PubChem CID 66669180) has the molecular formula C14H20N4
and a molecular weight of 244.34 g/mol. Its IUPAC name is 1H-1,2-benzodiazepine;diazepane.
Molecular Properties
| Compound Name | 1H-1,2-benzodiazepine;diazepane |
| PubChem CID | 66669180 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1H-1,2-benzodiazepine;diazepane |
| SMILES | C1=Cc2ccccc2NN=C1.C1CCNNCC1 |
| InChI | InChI=1S/C9H8N2.C5H12N2/c1-2-6-9-8(4-1)5-3-7-10-11-9;1-2-4-6-7-5-3-1/h1-7,11H;6-7H,1-5H2 |
| InChIKey | FWRTZDJBIUCQNL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-1,2-benzodiazepine;diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-1,2-benzodiazepine;diazepane?
The IUPAC name of 1H-1,2-benzodiazepine;diazepane (CID 66669180) is 1H-1,2-benzodiazepine;diazepane.
What is the SMILES notation for 1H-1,2-benzodiazepine;diazepane?
The canonical SMILES for 1H-1,2-benzodiazepine;diazepane is C1=Cc2ccccc2NN=C1.C1CCNNCC1.
What is the InChIKey of 1H-1,2-benzodiazepine;diazepane?
The InChIKey is FWRTZDJBIUCQNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C5H12N2/c1-2-6-9-8(4-1)5-3-7-10-11-9;1-2-4-6-7-5-3-1/h1-7,11H;6-7H,1-5H2.
What are the key properties of 1H-1,2-benzodiazepine;diazepane?
1H-1,2-benzodiazepine;diazepane has a molecular weight of 244.34 g/mol, XLogP of 2.38, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-1,2-benzodiazepine;diazepane is sourced from PubChem (CID 66669180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).