C15H30N2O2Si — CID 66669442
(3S,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one (PubChem CID 66669442) has the molecular formula C15H30N2O2Si and a molecular weight of 298.50 g/mol. Its IUPAC name is (3S,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | (3S,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 66669442 |
| Molecular Formula | C15H30N2O2Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (3S,8aS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one |
| SMILES | CN1C(=O)[C@@H]2CCCN2C[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30N2O2Si/c1-15(2,3)20(5,6)19-11-12-10-17-9-7-8-13(17)14(18)16(12)4/h12-13H,7-11H2,1-6H3/t12-,13-/m0/s1 |
| InChIKey | KRNLDGREVSUHFN-STQMWFEESA-N |
| XLogP | 2.31 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|