C8H15NO — CID 66669454
(3S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine (PubChem CID 66669454) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (3S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine.
| Compound Name | (3S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 66669454 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (3S,8aS)-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine |
| SMILES | C[C@H]1CN2CCC[C@H]2CO1 |
| InChI | InChI=1S/C8H15NO/c1-7-5-9-4-2-3-8(9)6-10-7/h7-8H,2-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | UBMVUISEIKGJGA-YUMQZZPRSA-N |
| XLogP | 0.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |