C19H24N4OS — CID 66669578
1-(2-methylthiophen-3-yl)-3-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]urea (PubChem CID 66669578) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 1-(2-methylthiophen-3-yl)-3-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]urea.
| Compound Name | 1-(2-methylthiophen-3-yl)-3-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]urea |
|---|---|
| PubChem CID | 66669578 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-(2-methylthiophen-3-yl)-3-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]urea |
| SMILES | Cc1sccc1NC(=O)NC1C2CCN(CC2)C1Cc1cccnc1 |
| InChI | InChI=1S/C19H24N4OS/c1-13-16(6-10-25-13)21-19(24)22-18-15-4-8-23(9-5-15)17(18)11-14-3-2-7-20-12-14/h2-3,6-7,10,12,15,17-18H,4-5,8-9,11H2,1H3,(H2,21,22,24) |
| InChIKey | SUTGXMVDGAECPK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |