C33H34N2O9 — CID 66669639
2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(2S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 66669639) has the molecular formula C33H34N2O9 and a molecular weight of 602.64 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(2S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-one.
| Compound Name | 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(2S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 66669639 |
| Molecular Formula | C33H34N2O9 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | 2,3-dihydroxy-2,3-bis(4-methylbenzoyl)butanedioic acid;(2S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | Cc1ccc(C(=O)C(O)(C(=O)O)C(O)(C(=O)O)C(=O)c2ccc(C)cc2)cc1.O=C1C2CCN(CC2)[C@H]1Cc1cccnc1 |
| InChI | InChI=1S/C20H18O8.C13H16N2O/c1-11-3-7-13(8-4-11)15(21)19(27,17(23)24)20(28,18(25)26)16(22)14-9-5-12(2)6-10-14;16-13-11-3-6-15(7-4-11)12(13)8-10-2-1-5-14-9-10/h3-10,27-28H,1-2H3,(H,23,24)(H,25,26);1-2,5,9,11-12H,3-4,6-8H2/t;12-/m.0/s1 |
| InChIKey | WWFGSZBDKKHLLO-WKEFIFSLSA-N |
| XLogP | 2.29 |
| TPSA | 182.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|