C6H11NO7 — CID 66669700
(2S,3S,4S,5R,6R)-2-amino-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid (PubChem CID 66669700) has the molecular formula C6H11NO7 and a molecular weight of 209.15 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-amino-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-2-amino-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 66669700 |
| Molecular Formula | C6H11NO7 |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-amino-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
| SMILES | N[C@]1(C(=O)O)O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11NO7/c7-6(5(12)13)3(10)1(8)2(9)4(11)14-6/h1-4,8-11H,7H2,(H,12,13)/t1-,2-,3+,4-,6+/m1/s1 |
| InChIKey | GJJPGFNDMBCBAT-HEIGXJMLSA-N |
| XLogP | -3.84 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |