About N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine
N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine (PubChem CID 66670157) has the molecular formula C14H19BrFNO
and a molecular weight of 316.21 g/mol. Its IUPAC name is N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine.
Molecular Properties
| Compound Name | N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine |
| PubChem CID | 66670157 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine |
| SMILES | CC1CC(NCc2ccc(F)c(Br)c2)CC(C)O1 |
| InChI | InChI=1S/C14H19BrFNO/c1-9-5-12(6-10(2)18-9)17-8-11-3-4-14(16)13(15)7-11/h3-4,7,9-10,12,17H,5-6,8H2,1-2H3 |
| InChIKey | KFKPPUSGZRKPMB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine?
The IUPAC name of N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine (CID 66670157) is N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine.
What is the SMILES notation for N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine?
The canonical SMILES for N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine is CC1CC(NCc2ccc(F)c(Br)c2)CC(C)O1.
What is the InChIKey of N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine?
The InChIKey is KFKPPUSGZRKPMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrFNO/c1-9-5-12(6-10(2)18-9)17-8-11-3-4-14(16)13(15)7-11/h3-4,7,9-10,12,17H,5-6,8H2,1-2H3.
What are the key properties of N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine?
N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine has a molecular weight of 316.21 g/mol, XLogP of 3.63, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-bromo-4-fluorophenyl)methyl]-2,6-dimethyloxan-4-amine is sourced from PubChem (CID 66670157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).