About 2-nitro-2,3-dihydro-1,3-thiazole
2-nitro-2,3-dihydro-1,3-thiazole (PubChem CID 66670328) has the molecular formula C3H4N2O2S
and a molecular weight of 132.14 g/mol. Its IUPAC name is 2-nitro-2,3-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-nitro-2,3-dihydro-1,3-thiazole |
| PubChem CID | 66670328 |
| Molecular Formula | C3H4N2O2S |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 132.00 |
| IUPAC Name | 2-nitro-2,3-dihydro-1,3-thiazole |
| SMILES | O=[N+]([O-])C1NC=CS1 |
| InChI | InChI=1S/C3H4N2O2S/c6-5(7)3-4-1-2-8-3/h1-4H |
| InChIKey | LJIZNLMSKXWIJK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-2,3-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-2,3-dihydro-1,3-thiazole?
The IUPAC name of 2-nitro-2,3-dihydro-1,3-thiazole (CID 66670328) is 2-nitro-2,3-dihydro-1,3-thiazole.
What is the SMILES notation for 2-nitro-2,3-dihydro-1,3-thiazole?
The canonical SMILES for 2-nitro-2,3-dihydro-1,3-thiazole is O=[N+]([O-])C1NC=CS1.
What is the InChIKey of 2-nitro-2,3-dihydro-1,3-thiazole?
The InChIKey is LJIZNLMSKXWIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2S/c6-5(7)3-4-1-2-8-3/h1-4H.
What are the key properties of 2-nitro-2,3-dihydro-1,3-thiazole?
2-nitro-2,3-dihydro-1,3-thiazole has a molecular weight of 132.14 g/mol, XLogP of 0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-2,3-dihydro-1,3-thiazole is sourced from PubChem (CID 66670328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).