About tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate
tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 66670504) has the molecular formula C21H25ClN6O2
and a molecular weight of 428.92 g/mol. Its IUPAC name is tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate |
| PubChem CID | 66670504 |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2cncc(-c3cnc4ccc(Cl)cn34)n2)C1 |
| InChI | InChI=1S/C21H25ClN6O2/c1-21(2,3)30-20(29)27-8-4-5-15(13-27)25-18-11-23-9-16(26-18)17-10-24-19-7-6-14(22)12-28(17)19/h6-7,9-12,15H,4-5,8,13H2,1-3H3,(H,25,26) |
| InChIKey | OKHMTSDKKHWSSS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate (CID 66670504) is tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCC(Nc2cncc(-c3cnc4ccc(Cl)cn34)n2)C1.
What is the InChIKey of tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate?
The InChIKey is OKHMTSDKKHWSSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25ClN6O2/c1-21(2,3)30-20(29)27-8-4-5-15(13-27)25-18-11-23-9-16(26-18)17-10-24-19-7-6-14(22)12-28(17)19/h6-7,9-12,15H,4-5,8,13H2,1-3H3,(H,25,26).
What are the key properties of tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate?
tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate has a molecular weight of 428.92 g/mol, XLogP of 4.26, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[[6-(6-chloroimidazo[1,2-a]pyridin-3-yl)pyrazin-2-yl]amino]piperidine-1-carboxylate is sourced from PubChem (CID 66670504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).