About hydron;pyrrole-2,5-dione;chloride
hydron;pyrrole-2,5-dione;chloride (PubChem CID 66670805) has the molecular formula C4H4ClNO2
and a molecular weight of 133.53 g/mol. Its IUPAC name is hydron;pyrrole-2,5-dione;chloride.
Molecular Properties
| Compound Name | hydron;pyrrole-2,5-dione;chloride |
| PubChem CID | 66670805 |
| Molecular Formula | C4H4ClNO2 |
| Molecular Weight | 133.53 g/mol |
| Exact Mass | 132.99 |
| IUPAC Name | hydron;pyrrole-2,5-dione;chloride |
| SMILES | O=C1C=CC(=O)N1.[Cl-].[H+] |
| InChI | InChI=1S/C4H3NO2.ClH/c6-3-1-2-4(7)5-3;/h1-2H,(H,5,6,7);1H |
| InChIKey | GXBDUKNALWQPMX-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.53 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze hydron;pyrrole-2,5-dione;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;pyrrole-2,5-dione;chloride?
The IUPAC name of hydron;pyrrole-2,5-dione;chloride (CID 66670805) is hydron;pyrrole-2,5-dione;chloride.
What is the SMILES notation for hydron;pyrrole-2,5-dione;chloride?
The canonical SMILES for hydron;pyrrole-2,5-dione;chloride is O=C1C=CC(=O)N1.[Cl-].[H+].
What is the InChIKey of hydron;pyrrole-2,5-dione;chloride?
The InChIKey is GXBDUKNALWQPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.ClH/c6-3-1-2-4(7)5-3;/h1-2H,(H,5,6,7);1H.
What are the key properties of hydron;pyrrole-2,5-dione;chloride?
hydron;pyrrole-2,5-dione;chloride has a molecular weight of 133.53 g/mol, XLogP of -3.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;pyrrole-2,5-dione;chloride is sourced from PubChem (CID 66670805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).