C25H39NO8 — CID 6667117
(2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6667117) has the molecular formula C25H39NO8 and a molecular weight of 481.59 g/mol. Its IUPAC name is (2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6667117 |
| Molecular Formula | C25H39NO8 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | (2S,3R,4R)-N-(2,2-dimethoxyethyl)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)N(C)CC(OC)OC)=C[C@@H](c2ccccc2)[C@H]1CCOCCOCCO |
| InChI | InChI=1S/C25H39NO8/c1-5-33-25-20(11-13-31-15-16-32-14-12-27)21(19-9-7-6-8-10-19)17-22(34-25)24(28)26(2)18-23(29-3)30-4/h6-10,17,20-21,23,25,27H,5,11-16,18H2,1-4H3/t20-,21+,25+/m1/s1 |
| InChIKey | NIIZAIAKIUXJGU-CZSZKKDXSA-N |
| XLogP | 2.16 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|