About 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium
1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium (PubChem CID 66671270) has the molecular formula C8H13N2+
and a molecular weight of 137.21 g/mol. Its IUPAC name is 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium |
| PubChem CID | 66671270 |
| Molecular Formula | C8H13N2+ |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.11 |
| IUPAC Name | 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium |
| SMILES | C=CC[N+]1(C=C)C=NCC1 |
| InChI | InChI=1S/C8H13N2/c1-3-6-10(4-2)7-5-9-8-10/h3-4,8H,1-2,5-7H2/q+1 |
| InChIKey | RDANHDOOXMSUFS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium?
The IUPAC name of 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium (CID 66671270) is 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium.
What is the SMILES notation for 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium?
The canonical SMILES for 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium is C=CC[N+]1(C=C)C=NCC1.
What is the InChIKey of 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium?
The InChIKey is RDANHDOOXMSUFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N2/c1-3-6-10(4-2)7-5-9-8-10/h3-4,8H,1-2,5-7H2/q+1.
What are the key properties of 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium?
1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium has a molecular weight of 137.21 g/mol, XLogP of 1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-1-prop-2-enyl-4,5-dihydroimidazol-1-ium is sourced from PubChem (CID 66671270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).